BIOPEP-UWM: Report
| ID | 11504 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 333.3813 | Monoisotopic mass | 333.1683 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cao R., Li W., Zhang J., Bao X., Feng H., Sun J., Liu X., Sun L. | |
| Title | |
| Milk casein hydrolysate peptides regulate starch digestion through inhibition of α-glucosidase: An insight into the active oligopeptide screening, enzyme inhibition behaviors, and oligopeptide-enzyme binding interactions. Food Hydrocolloids, 152, 109926, 2024 | |
| Year | Source |
| 2024 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C17H23N3O4/c1-11(17(23)24)19-16(22)14(10-12-6-3-2-4-7-12)20-15(21)13-8-5-9-18-13/h2-4,6-7,11,13-14,18H,5,8-10H2,1H3,(H,19,22)(H,20,21)(H,23,24)/t11-,13-,14-/m0/s1 InChIKey=ZUZINZIJHJFJRN-UBHSHLNASA-N |
| Database reference: |
| CAS: Registry No 175176-23-5 ChEBI: ID 162538 ChemSpider: ID 57533405 EPA CompTox: ID DTXSID20775809 J-GLOBAL: ID 200907066869889246 Metabolomics Workbench: ID 84916 Nikkaji: ID J1.140.413H PubChem: CID 71349985 SureChEMBL: ID 29947748 Wikidata: ID Q82737381 |