BIOPEP-UWM: Report
| ID | 11511 |
| Name | Cholesterol esterase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of cholesterol esterase (EC 3.1.1.13) | |||
| Number of residues | 4 |
Activity code | chei |
| Activity : | cholesterol esterase inhibitor |
|||
| Chemical mass | 464.5108 | Monoisotopic mass | 464.2263 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jia Z., Li H., Lu Y., Shi C., Wang Y., Chen X., Zhang W., Lu D., Cao W., Wang P., Wen P. | |
| Title | |
| Identification and molecular mechanism study of novel pancreatic lipase and cholesteryl esterase inhibitory peptides from yak whey protein hydrolysates. Food Chem., 520, 149706, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C22H32N4O7/c1-4-12(2)18(26-20(30)15(11-17(27)28)24-19(29)13(3)23)21(31)25-16(22(32)33)10-14-8-6-5-7-9-14/h5-9,12-13,15-16,18H,4,10-11,23H2,1-3H3,(H,24,29)(H,25,31)(H,26,30)(H,27,28)(H,32,33)/t12-,13-,15-,16-,18-/m0/s1 InChIKey=IXMZDCTUZCSVBJ-XRDYDQJJSA-N |
| Database reference: |