BIOPEP-UWM: Report
| ID | 11513 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer activity in cell cultures | |||
| Number of residues | 12 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 1198.4085 | Monoisotopic mass | 1197.7059 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhou M., Zou L., Gao J., Chen Y., Xi W., Xing X., Xiao G. | |
| Title | |
| A lactoferrin-derived peptide LRIPSKVDSAL exhibits selective anticancer activity with functional involvement of PI3K–Akt signaling. Food Biosci., 81, 109101, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C53H95N15O16/c1-10-29(8)41(67-45(76)33(16-13-19-58-53(56)57)60-43(74)31(55)21-26(2)3)51(82)68-20-14-17-38(68)49(80)65-37(25-70)48(79)61-32(15-11-12-18-54)44(75)66-40(28(6)7)50(81)62-34(23-39(71)72)46(77)64-36(24-69)47(78)59-30(9)42(73)63-35(52(83)84)22-27(4)5/h26-38,40-41,69-70H,10-25,54-55H2,1-9H3,(H,59,78)(H,60,74)(H,61,79)(H,62,81)(H,63,73)(H,64,77)(H,65,80)(H,66,75)(H,67,76)(H,71,72)(H,83,84)(H4,56,57,58)/t29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,40-,41-/m0/s1 InChIKey=PZFWNRRLQYFLHL-WFBCUNTCSA-N |
| Database reference: |