BIOPEP-UWM: Report
| ID | 11543 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 8 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 846.9692 | Monoisotopic mass | 846.4375 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shen W., Wang X., Li R., Liu S., Xing R., Li P., Yu H. | |
| Title | |
| Identification of novel anti-inflammatory peptides from jellyfish Nemopilema nomurai enzymatic hydrolysate: an integrated in silico analysis and cellular evaluation. Mar. Drugs, 24, 192, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C42H58N10O9/c1-25(2)35(41(59)51-18-8-14-32(51)39(57)50-17-7-13-31(50)40(58)52-19-9-15-33(52)42(60)61)49-38(56)30(21-27-22-43-24-46-27)48-37(55)29(20-26-10-4-3-5-11-26)47-34(53)23-45-36(54)28-12-6-16-44-28/h3-5,10-11,22,24-25,28-33,35,44H,6-9,12-21,23H2,1-2H3,(H,43,46)(H,45,54)(H,47,53)(H,48,55)(H,49,56)(H,60,61)/t28-,29-,30-,31-,32-,33-,35-/m0/s1 InChIKey=TZQWQNYGJMNFJY-SIMWSORWSA-N |
| Database reference: |