BIOPEP-UWM: Report
| ID | 11544 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 8 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 771.8582 | Monoisotopic mass | 771.3903 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shen W., Wang X., Li R., Liu S., Xing R., Li P., Yu H. | |
| Title | |
| Identification of novel anti-inflammatory peptides from jellyfish Nemopilema nomurai enzymatic hydrolysate: an integrated in silico analysis and cellular evaluation. Mar. Drugs, 24, 192, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C36H53N9O10/c37-14-2-1-6-24(42-34(52)27-8-3-15-43(27)30(48)19-38)32(50)39-20-29(47)41-25(18-22-10-12-23(46)13-11-22)35(53)45-17-4-7-26(45)33(51)40-21-31(49)44-16-5-9-28(44)36(54)55/h10-13,24-28,46H,1-9,14-21,37-38H2,(H,39,50)(H,40,51)(H,41,47)(H,42,52)(H,54,55)/t24-,25-,26-,27-,28-/m0/s1 InChIKey=HWKAJODIVMOHIM-XLIKFSOKSA-N |
| Database reference: |