BIOPEP-UWM: Report
| ID | 11545 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 11 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1044.0774 | Monoisotopic mass | 1043.5093 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang J., Lin F., Mei Y., Xie R., Chen J., Hu J., Du H., Hao G., Li S., Chen W. | |
| Title | |
| Unlocking collagen-derived novel antioxidant peptides from by-product bones of silver carp: label-free peptidomic discovery, bioinformatics-aided mechanistic elucidation, and cytoprotective effects against oxidative damage. Food Res. Int., 239, 119536, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C40H69N17O16/c1-19(32(66)48-15-28(62)53-23(38(72)73)7-4-12-47-40(44)45)51-36(70)25-8-5-13-57(25)29(63)17-50-37(71)31(20(2)59)56-34(68)22(9-10-30(64)65)52-27(61)16-49-33(67)21(6-3-11-46-39(42)43)55-35(69)24(18-58)54-26(60)14-41/h19-25,31,58-59H,3-18,41H2,1-2H3,(H,48,66)(H,49,67)(H,50,71)(H,51,70)(H,52,61)(H,53,62)(H,54,60)(H,55,69)(H,56,68)(H,64,65)(H,72,73)(H4,42,43,46)(H4,44,45,47)/t19-,20+,21-,22-,23-,24-,25-,31-/m0/s1 InChIKey=JOCSYNBJIFYYBB-JAPYPWHCSA-N |
| Database reference: |