BIOPEP-UWM: Report
| ID | 11546 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 12 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1081.1834 | Monoisotopic mass | 1080.5772 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang J., Lin F., Mei Y., Xie R., Chen J., Hu J., Du H., Hao G., Li S., Chen W. | |
| Title | |
| Unlocking collagen-derived novel antioxidant peptides from by-product bones of silver carp: label-free peptidomic discovery, bioinformatics-aided mechanistic elucidation, and cytoprotective effects against oxidative damage. Food Res. Int., 239, 119536, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C44H76N18O14/c1-22(2)34(60-38(71)25(57-30(64)17-45)9-5-13-50-43(46)47)41(74)54-20-33(67)62-16-8-12-29(62)40(73)59-27(21-63)37(70)53-19-32(66)61-15-7-11-28(61)39(72)56-23(3)35(68)52-18-31(65)55-24(4)36(69)58-26(42(75)76)10-6-14-51-44(48)49/h22-29,34,63H,5-21,45H2,1-4H3,(H,52,68)(H,53,70)(H,54,74)(H,55,65)(H,56,72)(H,57,64)(H,58,69)(H,59,73)(H,60,71)(H,75,76)(H4,46,47,50)(H4,48,49,51)/t23-,24-,25-,26-,27-,28-,29-,34-/m0/s1 InChIKey=HHHFJBUIVUBOLZ-JCVYRXDLSA-N |
| Database reference: |