BIOPEP-UWM: Report
| ID | 11547 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 926.0259 | Monoisotopic mass | 925.4966 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang J., Lin F., Mei Y., Xie R., Chen J., Hu J., Du H., Hao G., Li S., Chen W. | |
| Title | |
| Unlocking collagen-derived novel antioxidant peptides from by-product bones of silver carp: label-free peptidomic discovery, bioinformatics-aided mechanistic elucidation, and cytoprotective effects against oxidative damage. Food Res. Int., 239, 119536, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C39H67N13O13/c1-19(2)15-25(34(60)51-31(20(3)4)36(62)46-16-27(53)47-22(6)33(59)50-24(38(64)65)9-7-13-43-39(41)42)49-29(55)18-45-35(61)26-10-8-14-52(26)37(63)23(11-12-30(56)57)48-28(54)17-44-32(58)21(5)40/h19-26,31H,7-18,40H2,1-6H3,(H,44,58)(H,45,61)(H,46,62)(H,47,53)(H,48,54)(H,49,55)(H,50,59)(H,51,60)(H,56,57)(H,64,65)(H4,41,42,43)/t21-,22-,23-,24-,25-,26-,31-/m0/s1 InChIKey=FZLKYLGKOZOKPL-SKXPDWFXSA-N |
| Database reference: |