BIOPEP-UWM: Report
| ID | 11551 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 497.6297 | Monoisotopic mass | 497.3316 | |
| IC50 : | 3.44 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach, Food Chem., 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C23H43N7O5/c1-13(2)11-15(24)19(31)29-17(12-14(3)4)20(32)28-16(7-5-9-27-23(25)26)21(33)30-10-6-8-18(30)22(34)35/h13-18H,5-12,24H2,1-4H3,(H,28,32)(H,29,31)(H,34,35)(H4,25,26,27)/t15-,16-,17-,18-/m0/s1 InChIKey=JOOVDHALZQWTSF-XSLAGTTESA-N |
| Database reference: |
| PubChem: CID 176287603 SureChEMBL: ID SCHEMBL31481586 |