BIOPEP-UWM: Report
| ID | 11552 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 707.8210 | Monoisotopic mass | 707.3857 | |
| IC50 : | 17.67 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach, Food Chem., 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C34H49N11O6/c1-19(2)13-23(35)29(46)43-26(15-21-17-38-18-41-21)30(47)44-27(14-20-16-40-24-8-4-3-7-22(20)24)32(49)45-12-6-10-28(45)31(48)42-25(33(50)51)9-5-11-39-34(36)37/h3-4,7-8,16-19,23,25-28,40H,5-6,9-15,35H2,1-2H3,(H,38,41)(H,42,48)(H,43,46)(H,44,47)(H,50,51)(H4,36,37,39)/t23-,25-,26-,27-,28-/m0/s1 InChIKey=NEUWWSCYYXGNJE-BLVAWXTGSA-N |
| Database reference: |