BIOPEP-UWM: Report
| ID | 11553 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 547.6883 | Monoisotopic mass | 547.3472 | |
| IC50 : | 42.52 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach, Food Chem., 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H45N7O5/c1-16(2)13-19(28)23(35)33-22(15-18-9-6-5-7-10-18)25(37)34-21(14-17(3)4)24(36)32-20(26(38)39)11-8-12-31-27(29)30/h5-7,9-10,16-17,19-22H,8,11-15,28H2,1-4H3,(H,32,36)(H,33,35)(H,34,37)(H,38,39)(H4,29,30,31)/t19-,20-,21-,22-/m0/s1 InChIKey=LRRAHTYIVLYWGX-CMOCDZPBSA-N |
| Database reference: |