BIOPEP-UWM: Report
| ID | 11555 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 7 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 790.8598 | Monoisotopic mass | 790.4171 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tu M., Feng L., Wang Z., Qiao M., Shahidi F., Lu W., Du M. | |
| Title | |
| Sequence analysis and molecular docking of antithrombotic peptides from casein hydrolysate by trypsin digestion. J. Funct. Foods, 32, 313-323, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C32H58N10O13/c1-13(2)10-18(26(49)40-20(12-43)27(50)39-19(31(54)55)11-21(46)47)38-25(48)17(8-7-9-36-32(34)35)37-30(53)24(16(6)45)42-29(52)23(14(3)4)41-28(51)22(33)15(5)44/h13-20,22-24,43-45H,7-12,33H2,1-6H3,(H,37,53)(H,38,48)(H,39,50)(H,40,49)(H,41,51)(H,42,52)(H,46,47)(H,54,55)(H4,34,35,36)/t15-,16-,17+,18+,19+,20+,22+,23+,24+/m1/s1 InChIKey=LYZLUGCJLXGOEQ-BZNRZFJGSA-N |
| Database reference: |