BIOPEP-UWM: Report
| ID | 11556 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 8 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 886.9899 | Monoisotopic mass | 886.4857 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tu M., Feng L., Wang Z., Qiao M., Shahidi F., Lu W., Du M. | |
| Title | |
| Sequence analysis and molecular docking of antithrombotic peptides from casein hydrolysate by trypsin digestion. J. Funct. Foods, 32, 313-323, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C37H66N12O13/c1-17(2)14-22(36(61)62)45-34(59)28(19(5)52)48-31(56)24(16-51)46-29(54)20(8-6-12-42-37(40)41)43-32(57)25-9-7-13-49(25)35(60)21(10-11-26(38)53)44-30(55)23(15-50)47-33(58)27(39)18(3)4/h17-25,27-28,50-52H,6-16,39H2,1-5H3,(H2,38,53)(H,43,57)(H,44,55)(H,45,59)(H,46,54)(H,47,58)(H,48,56)(H,61,62)(H4,40,41,42)/t19-,20+,21+,22+,23+,24+,25+,27+,28+/m1/s1 InChIKey=SPLGAJWJTOGDDE-XZJXUQCBSA-N |
| Database reference: |