BIOPEP-UWM: Report
| ID | 11560 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 536.5650 | Monoisotopic mass | 537.2419 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| You R., Xu J., Min J., Wang S., Hu Y., Chen X., Ren M., Ma X., Zhang S. | |
| Title | |
| Identification of selenopeptides from selenium-enriched Pleurotus ostreatus protein hydrolysates and their immune-enhancing effects in macrophages. J. Food Measur. Charact., 20, 9380–9395, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC[Se]C)C(=O)O InChI=1S/C22H43N5O5Se/c1-13(2)12-17(26-19(28)15(24)8-6-7-10-23)20(29)27-18(14(3)4)21(30)25-16(22(31)32)9-11-33-5/h13-18H,6-12,23-24H2,1-5H3,(H,25,30)(H,26,28)(H,27,29)(H,31,32)/t15-,16-,17-,18-/m0/s1 InChIKey=HNOMJVLIBYRWLZ-XSLAGTTESA-N {SeM} - Selenomethionine; ID 128 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |