BIOPEP-UWM: Report
| ID | 11571 |
| Name | Antibiofilm peptide |
| sequence |
| Function: | |||
| Antibiofilm | |||
| Number of residues | 12 |
Activity code | abf |
| Activity : | antibiofilm |
|||
| Chemical mass | 1421.8065 | Monoisotopic mass | 1420.9142 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| You J., Mslati H., Haney E. F., Akhoundsadegh N., Hancock R. E. W., Cherkasov A. | |
| Title | |
| The use of DeepQSAR models for the discovery of peptides with enhanced antimicrobial and antibiofilm potential. Mol. Inf., 45, e70029, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C71H120N16O14/c1-42(2)36-49(76)61(90)82-56(39-47-24-12-10-13-25-47)68(97)80-51(29-17-21-33-73)64(93)84-57(40-48-26-14-11-15-27-48)69(98)83-54(37-43(3)4)62(91)77-41-58(89)78-50(28-16-20-32-72)63(92)79-52(30-18-22-34-74)65(94)86-59(45(7)8)70(99)85-55(38-44(5)6)67(96)81-53(31-19-23-35-75)66(95)87-60(46(9)88)71(100)101/h10-15,24-27,42-46,49-57,59-60,88H,16-23,28-41,72-76H2,1-9H3,(H,77,91)(H,78,89)(H,79,92)(H,80,97)(H,81,96)(H,82,90)(H,83,98)(H,84,93)(H,85,99)(H,86,94)(H,87,95)(H,100,101)/t46-,49+,50+,51+,52+,53+,54+,55+,56+,57+,59+,60+/m1/s1 InChIKey=PFONSFZNNZVDBU-BUGBONKWSA-N |
| Database reference: |