BIOPEP-UWM: Report
| ID | 11582 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 5 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 384.5088 | Monoisotopic mass | 384.2615 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chowdhary R., Mustafa G., Sarkar A. R., Sharma S., Ahmed M., Pandian R., Ahmed Z., Shukla S. K., Rai R. | |
| Title | |
| In-vitro and in-vivo evaluation of β/α hybrid peptides against colorectal cancer. Int. J. Pept. Res. Therapeut., 32, 82, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: CC(C)(C)OC(=O)NCC1(CCCCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)OC InChI=1S/C20H36N2O5/c1-14(2)12-15(16(23)26-6)22-17(24)20(10-8-7-9-11-20)13-21-18(25)27-19(3,4)5/h14-15H,7-13H2,1-6H3,(H,21,25)(H,22,24)/t15-/m0/s1 InChIKey=RBJMGEAZIKDWPR-HNNXBMFYSA-N {[1CH3;1CH3]C2!} - Tert-butanol - precursor of N-terminal group, ID 292 in the BIOPEP-UWM repository of amino acids and modifications {H2CO3} - Carbonic acid, ID 228 in the BIOPEP-UWM repository of amino acids and modifications {!OC1} - C-terminal methanol, ID 233 in the BIOPEP-UWM repository of amino acids and modifications {[1CH3;1CH3]C2!}{H2CO3} - N-terminal Boc group |
| Database reference: |