BIOPEP-UWM: Report
| ID | 11586 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 5 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 536.7449 | Monoisotopic mass | 536.3925 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chowdhary R., Mustafa G., Sarkar A. R., Sharma S., Ahmed M., Pandian R., Ahmed Z., Shukla S. K., Rai R. | |
| Title | |
| In-vitro and in-vivo evaluation of β/α hybrid peptides against colorectal cancer. Int. J. Pept. Res. Therapeut., 32, 82, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC1(CCCCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC1(CCCCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)OC InChI=1S/C29H52N4O5/c1-20(2)16-22(32-26(36)28(18-30)12-8-6-9-13-28)24(34)31-19-29(14-10-7-11-15-29)27(37)33-23(17-21(3)4)25(35)38-5/h20-23H,6-19,30H2,1-5H3,(H,31,34)(H,32,36)(H,33,37)/t22-,23-/m0/s1 InChIKey=LFDQCCAWKLYDCS-GOTSBHOMSA-N {!OC1} - C-terminal methanol, ID 233 in the BIOPEP-UWM repository of amino acids and modifications {βA[2!;2!cC6:0]} - 1-(Aminomethyl)cyclohexane-1-carboxylic acid; ID 291 in the BIOPEP-UWM repository of amino acids and modifications |
| Database reference: |