BIOPEP-UWM: Report
| ID | 11588 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 781.9600 | Monoisotopic mass | 781.3820 | |
| IC50 : | 770.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xu Y., Li D., Wang H., Zhang Y., Rong L., Li R. | |
| Title | |
| Peptidomics-driven screening of ACE inhibitory peptides from cheese: Molecular mechanisms and modulation of endothelial function in HUVECs. Food Biosci., 83, 109500, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C39H55N7O8S/c1-55-22-18-28(41)37(51)45-20-7-12-32(45)36(50)43-30(23-25-9-3-2-4-10-25)38(52)46-21-8-13-33(46)35(49)42-29(11-5-6-19-40)34(48)44-31(39(53)54)24-26-14-16-27(47)17-15-26/h2-4,9-10,14-17,28-33,47H,5-8,11-13,18-24,40-41H2,1H3,(H,42,49)(H,43,50)(H,44,48)(H,53,54)/t28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=YEKUHHHXAZQNFM-FSJACQRISA-N |
| Database reference: |