BIOPEP-UWM: Report
| ID | 11591 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 4 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 545.6280 | Monoisotopic mass | 545.2630 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zang X., Zhou S., Guo X., Yang G., Shi K., Wang L., Zhang Z., Sun J. | |
| Title | |
| Hypoglycemic peptides from Xanthoceras sorbifolium Bunge seed meal: Preparation, identification, and mechanism via PI3K/Akt/GSK-3β signaling. Food Biosci., 83, 109601, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C30H35N5O5/c31-22(16-19-8-2-1-3-9-19)28(37)34-14-6-12-25(34)27(36)33-24(29(38)35-15-7-13-26(35)30(39)40)17-20-18-32-23-11-5-4-10-21(20)23/h1-5,8-11,18,22,24-26,32H,6-7,12-17,31H2,(H,33,36)(H,39,40)/t22-,24-,25-,26-/m0/s1 InChIKey=RNBWDDXYITUWJR-GKXKVECMSA-N |
| Database reference: |