BIOPEP-UWM: Report
| ID | 11592 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 632.7480 | Monoisotopic mass | 632.3312 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zang X., Zhou S., Guo X., Yang G., Shi K., Wang L., Zhang Z., Sun J. | |
| Title | |
| Hypoglycemic peptides from Xanthoceras sorbifolium Bunge seed meal: Preparation, identification, and mechanism via PI3K/Akt/GSK-3β signaling. Food Biosci., 83, 109601, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C34H44N6O6/c1-20(2)16-25(35)33(44)40-15-9-14-29(40)32(43)37-21(3)30(41)38-27(18-23-19-36-26-13-8-7-12-24(23)26)31(42)39-28(34(45)46)17-22-10-5-4-6-11-22/h4-8,10-13,19-21,25,27-29,36H,9,14-18,35H2,1-3H3,(H,37,43)(H,38,41)(H,39,42)(H,45,46)/t21-,25-,27-,28-,29-/m0/s1 InChIKey=UOYUSPHPHSNUMZ-VGUKBLNFSA-N |
| Database reference: |