BIOPEP-UWM: Report
| ID | 11598 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 519.5908 | Monoisotopic mass | 519.2474 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang T., Liu Y., Shi Y., Wang Y., Zhu R., Liu C., Sun H., Yi H. | |
| Title | |
| Integrated discovery and mechanistic characterization of xanthine oxidase inhibitory peptides from sheep milk. Food Chem. X, 37, 104179, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C28H33N5O5/c1-17(31-26(35)21(29)14-18-8-3-2-4-9-18)25(34)32-23(27(36)33-13-7-12-24(33)28(37)38)15-19-16-30-22-11-6-5-10-20(19)22/h2-6,8-11,16-17,21,23-24,30H,7,12-15,29H2,1H3,(H,31,35)(H,32,34)(H,37,38)/t17-,21-,23-,24-/m0/s1 InChIKey=NQSYEKDYWHTKTK-OXMFBNLJSA-N |
| Database reference: |