BIOPEP-UWM: Report
| ID | 11599 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 4 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 507.5388 | Monoisotopic mass | 507.2434 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang T., Liu Y., Shi Y., Wang Y., Zhu R., Liu C., Sun H., Yi H. | |
| Title | |
| Integrated discovery and mechanistic characterization of xanthine oxidase inhibitory peptides from sheep milk. Food Chem. X, 37, 104179, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C22H33N7O7/c23-14(11-13-5-2-1-3-6-13)19(33)27-12-17(30)28-15(8-9-18(31)32)20(34)29-16(21(35)36)7-4-10-26-22(24)25/h1-3,5-6,14-16H,4,7-12,23H2,(H,27,33)(H,28,30)(H,29,34)(H,31,32)(H,35,36)(H4,24,25,26)/t14-,15-,16-/m0/s1 InChIKey=WCWHPFCTIPPGNZ-JYJNAYRXSA-N |
| Database reference: |
| J-GLOBAL: ID 200907049502889817 Nikkaji: ID J2.250.651J PubChem: CID 101375993 SureChEMBL: ID SCHEMBL29575938 |