BIOPEP-UWM: Report
| ID | 11600 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 5 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 614.6453 | Monoisotopic mass | 614.2691 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang T., Liu Y., Shi Y., Wang Y., Zhu R., Liu C., Sun H., Yi H. | |
| Title | |
| Integrated discovery and mechanistic characterization of xanthine oxidase inhibitory peptides from sheep milk. Food Chem. X, 37, 104179, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C29H38N6O9/c1-15(32-26(40)21(14-23(30)38)34-28(42)24(31)16(2)36)25(39)33-20(12-18-8-10-19(37)11-9-18)27(41)35-22(29(43)44)13-17-6-4-3-5-7-17/h3-11,15-16,20-22,24,36-37H,12-14,31H2,1-2H3,(H2,30,38)(H,32,40)(H,33,39)(H,34,42)(H,35,41)(H,43,44)/t15-,16+,20-,21-,22-,24-/m0/s1 InChIKey=VWJBKJMHPRXIIK-LPOVAUAMSA-N |
| Database reference: |