BIOPEP-UWM: Report
| ID | 11601 |
| Name | Xanthine oxidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Xanthine oxidase (EC 1.17.3.2) | |||
| Number of residues | 3 |
Activity code | xox |
| Activity : | xanthine oxidase inhibitor |
|||
| Chemical mass | 425.4765 | Monoisotopic mass | 425.1944 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang T., Liu Y., Shi Y., Wang Y., Zhu R., Liu C., Sun H., Yi H. | |
| Title | |
| Integrated discovery and mechanistic characterization of xanthine oxidase inhibitory peptides from sheep milk. Food Chem. X, 37, 104179, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C23H27N3O5/c24-18(13-16-8-10-17(27)11-9-16)22(29)26-12-4-7-20(26)21(28)25-19(23(30)31)14-15-5-2-1-3-6-15/h1-3,5-6,8-11,18-20,27H,4,7,12-14,24H2,(H,25,28)(H,30,31)/t18-,19-,20-/m0/s1 InChIKey=RCMWNNJFKNDKQR-UFYCRDLUSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database Opioid peptide according to the BIOPEP-UWM database of bioactive peptides (ID 2870) Bitter peptide according to BIOPEP-UWM database of sensory peptides and amino acids (ID 73) |
| Database reference: |
| AHTPDB: ID 2291; 4597; 4855; 5511; 5939 BindingDB: ID 50139021 BioPepDB: ID biopep01592 BIOPEP-UWM database of bioactive peptides: ID 2870 BIOPEP-UWM database of sensory peptides and amino acids: ID 73 BRENDA: Ligand Tyr-Pro-Phe ChEBI: ID 165948 ChEMBL: ID CHEMBL164030 ChemSpider: ID 8178106 EPA DSSTox: ID DTXCID50356261 EROP-Moscow: ID E09283 J-GLOBAL: ID 200907066679107020 Nikkaji: ID J394.110H PubChem: CID 10002525 SATPdb: ID satpdb17904 SureChEMBL: ID 30423227 UniChem: ID 462890 Wikidata: ID Q106029040 |