BIOPEP-UWM: Report
| ID | 11609 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 876.0086 | Monoisotopic mass | 875.4850 | |
| IC50 : | 716.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gómez Ruiz J. Á., Ramos M., Recio I. | |
| Title | |
| Angiotensin converting enzyme-inhibitory activity of peptides isolated from Manchego cheese. Stability under simulated gastrointestinal digestion. Int. Dairy J., 14, 1075-1080, 2004 | |
| Year | Source |
| 2004 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C40H65N11O11/c1-22(2)33(39(60)51-19-7-10-30(51)38(59)47-27(40(61)62)15-16-31(44)53)50-37(58)29(21-32(45)54)49-36(57)28(20-23-11-13-24(52)14-12-23)48-35(56)26(9-4-6-18-42)46-34(55)25(43)8-3-5-17-41/h11-14,22,25-30,33,52H,3-10,15-21,41-43H2,1-2H3,(H2,44,53)(H2,45,54)(H,46,55)(H,47,59)(H,48,56)(H,49,57)(H,50,58)(H,61,62)/t25-,26-,27-,28-,29-,30-,33-/m0/s1 InChIKey=LKCOBLZPRPHZNM-ODPDCLKQSA-N |
| Database reference: |
| AHTPDB: ID 3621, 4191, 4310, 5040, 5709 MBPDB: Peptide KKYNVPQ SATPdb: ID satpdb18361 |