BIOPEP-UWM: Report
| ID | 11612 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 697.8607 | Monoisotopic mass | 697.4360 | |
| IC50 : | 1275.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gómez Ruiz J. Á., Ramos M., Recio I. | |
| Title | |
| Angiotensin converting enzyme-inhibitory activity of peptides isolated from Manchego cheese. Stability under simulated gastrointestinal digestion. Int. Dairy J., 14, 1075-1080, 2004 | |
| Year | Source |
| 2004 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C33H59N7O9/c1-7-20(6)27(39-29(44)22(13-14-25(41)42)36-28(43)21(35)17-18(2)3)31(46)38-26(19(4)5)32(47)40-16-10-12-24(40)30(45)37-23(33(48)49)11-8-9-15-34/h18-24,26-27H,7-17,34-35H2,1-6H3,(H,36,43)(H,37,45)(H,38,46)(H,39,44)(H,41,42)(H,48,49)/t20-,21-,22-,23-,24-,26-,27-/m0/s1 InChIKey=FMGKUDFGYOKBMZ-RNIUOSIHSA-N |
| Database reference: |