BIOPEP-UWM: Report
| ID | 11613 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 447.3863 | Monoisotopic mass | 448.1218 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen L., Nie M., Yang J., Zhang W., Hsiang T., Jiang Y., Xie B., Chen B. | |
| Title | |
| Structural identification and molecular interaction modeling analysis of antioxidant activity selenium-enriched peptides from selenium-enriched Pleurotus eryngii. Antioxidants, 14, 586, 2025 | |
| Year | Source |
| 2025 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC[Se]C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C17H28N4O5Se/c1-27-9-6-11(18)16(24)21-8-2-4-12(21)15(23)19-10-14(22)20-7-3-5-13(20)17(25)26/h11-13H,2-10,18H2,1H3,(H,19,23)(H,25,26)/t11-,12-,13-/m0/s1 InChIKey=CYUHSKMRIZVSLP-AVGNSLFASA-N |
| Database reference: |