BIOPEP-UWM: Report
| ID | 11616 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Lowering blood pressure in rats | |||
| Number of residues | 3 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 359.4185 | Monoisotopic mass | 359.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen C.-C., Hou Y.-J., Lo H.-Y., Stevens M.-L., Hsiang C.-Y., Ho T.-Y. | |
| Title | |
| Integrated abundance analysis and artificial intelligence-assisted screening reveal novel antihypertensive milk-derived tripeptides. Food Chem., 530, 151275, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C19H25N3O4/c23-17(14-8-4-10-20-14)21-15(12-13-6-2-1-3-7-13)18(24)22-11-5-9-16(22)19(25)26/h1-3,6-7,14-16,20H,4-5,8-12H2,(H,21,23)(H,25,26)/t14-,15-,16-/m0/s1 InChIKey=ZVEQWRWMRFIVSD-JYJNAYRXSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9565) Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 69) |
| Database reference: |
| AHTPDB: ID 2276; 4315; 4570; 4827; 5484 BioPepDB: ID biopep01041 BIOPEP-UWM database of bioactive peptides: ID 9565 BIOPEP-UWM database of sensory peptide and amino acids: ID 69 BRENDA: Ligand Pro-Phe-Pro CAS: Registry No 58705-25-2 ChemSpider: ID 9849616 EPA CompTox: ID DTXSID80470444 MBPDB: Peptide PFP PubChem: CID 11674887 SATPdb: ID satpdb10031 SureChEMBL: ID SCHEMBL29878760 UniChem: ID 34134764 Wikidata: ID Q82298537 |