BIOPEP-UWM: Report
| ID | 11620 |
| Name | Hypotensive peptide |
| sequence |
| Function: | |||
| Lowering blood pressure in rats | |||
| Number of residues | 3 |
Activity code | hyp |
| Activity : | hypotensive |
|||
| Chemical mass | 327.4180 | Monoisotopic mass | 327.2151 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen C.-C., Hou Y.-J., Lo H.-Y., Stevens M.-L., Hsiang C.-Y., Ho T.-Y. | |
| Title | |
| Integrated abundance analysis and artificial intelligence-assisted screening reveal novel antihypertensive milk-derived tripeptides. Food Chem., 530, 151275, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C16H29N3O4/c1-5-10(4)12(17)14(20)18-13(9(2)3)15(21)19-8-6-7-11(19)16(22)23/h9-13H,5-8,17H2,1-4H3,(H,18,20)(H,22,23)/t10-,11-,12-,13-/m0/s1 InChIKey=RQZFWBLDTBDEOF-CYDGBPFRSA-N |
| Database reference: |
| CAS: Registry No 918424-42-7 ChemSpider: ID 13164481 EPA CompTox: ID DTXSID00581162 PubChem: CID 16035882 SureChEMBL: ID SCHEMBL30051254 UniChem: ID 32882907 Wikidata: ID Q82472204 |