BIOPEP-UWM: Report
| ID | 2566 |
| Name | regulating cell-permeability peptide |
| sequence |
| Function: | |||
| regulating cell-permeable function | |||
| Number of residues | 7 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 890.0780 | Monoisotopic mass | 889.5369 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du D. G., Yao S. Y., Rojas M., Lin Y. Z. | |
| Title | |
| Conformational and topological requirements of cell-permeable peptide function. J. Peptide Res., 51, 235-243 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C42H71N11O10/c1-25(2)22-33(42(62)63)52-38(58)30(11-4-7-19-44)49-40(60)34-13-9-21-53(34)41(61)31(12-5-8-20-45)50-37(57)29(10-3-6-18-43)48-39(59)32(23-26-14-16-27(54)17-15-26)51-36(56)28(46)24-35(47)55/h14-17,25,28-34,54H,3-13,18-24,43-46H2,1-2H3,(H2,47,55)(H,48,59)(H,49,60)(H,50,57)(H,51,56)(H,52,58)(H,62,63)/t28-,29-,30-,31-,32-,33-,34-/m0/s1 InChIKey: RQFNGWRPSKHMKK-NXBWRCJVSA-N |
| Database reference: |