BIOPEP-UWM: Report
| ID | 2573 |
| Name | Precursor of vasopressin |
| sequence |
| Function: | |||
| Precursor of neuropeptide | |||
| Number of residues | 10 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 1144.2830 | Monoisotopic mass | 1143.4575 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hruby V. J., Chow M., Smith D. D. | |
| Title | |
| Conformational and structural considerations in oxitocin-receptor binding and biological activity. Annu. Rev. Pharmacol. Toxicol., 30, 501-534 (1990) | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CS)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)NCC(=O)O InChI=1S/C48H69N15O14S2/c49-28(23-78)40(70)59-31(19-26-10-12-27(64)13-11-26)44(74)60-32(18-25-6-2-1-3-7-25)43(73)57-30(14-15-36(50)65)42(72)61-33(20-37(51)66)45(75)62-34(24-79)47(77)63-17-5-9-35(63)46(76)58-29(8-4-16-54-48(52)53)41(71)56-21-38(67)55-22-39(68)69/h1-3,6-7,10-13,28-35,64,78-79H,4-5,8-9,14-24,49H2,(H2,50,65)(H2,51,66)(H,55,67)(H,56,71)(H,57,73)(H,58,76)(H,59,70)(H,60,74)(H,61,72)(H,62,75)(H,68,69)(H4,52,53,54)/t28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey: CPUMTTGYTMPHJF-DZCXQCEKSA-N The active form is C-terminal amide group instead of C-terminal glycine residue. Peptide is the precursor of vasopressin (ID 2572 in BIOPEP-UWM database of bioactive peptides). Reviews concerning C-terminal amidation of peptides: Bradbury A. F., Smyth D. G., 1991, Peptide amidation. Trends Biochem. Sci., 16, 112-115 Merkler D. J., 1994, C-terminal amidated peptides: production by the in vitro enzymatic amidation of glycine-extended peptides and the importance of the amide to bioactivity. Enzyme Microb. Technol., 16, 450-456 |
| Database reference: |