BIOPEP-UWM: Report
| ID | 2575 |
| Name | tuftsin |
| sequence |
| Function: | |||
| Immunomodulating peptide | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 500.5907 | Monoisotopic mass | 500.3062 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wieczorek Z., Zimecki M., Słoń J. J., Siemion I. Z. | |
| Title | |
| The immunomodulatory activity of tetra-and tripeptides of tuftsin-kentsin group. Peptides,15, 215-221, 1994 | |
| Year | Source |
| 1994 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@](C(N[C@](C(N1CCC[C@]1(C(N[C@](C(O)=O)(CCCNC(N)=N)[H])=O)[H])=O)(CCCCN)[H])=O)([C@@H](C)O)[H] InChI=1S/C21H40N8O6/c1-12(30)16(23)18(32)27-13(6-2-3-9-22)19(33)29-11-5-8-15(29)17(31)28-14(20(34)35)7-4-10-26-21(24)25/h12-16,30H,2-11,22-23H2,1H3,(H,27,32)(H,28,31)(H,34,35)(H4,24,25,26)/t12-,13+,14+,15+,16+/m1/s1 InChIKey: IESDGNYHXIOKRW-YXMSTPNBSA-N The first reference concerning peptide: Nishioka K. ,Constantopoulos A. ,Satoh P. S., Najjar V. A., 1972, The characteristics, isolation and synthesis of the phagocytosis stimulating peptide tuftsin. Biochem. Biophys. Res. Commun., 47, 172-179 |
| Database reference: |
| ChEBI: ID 88947 ChEMBL: ID CHEMBL356299 ChemIDplus: ID 112592902 ChemSpider: ID 137461 EPA CompTox: ID DTXSID60658460 EROP-Moscow: ID E00115 FDA UNII - NLM: ID QF5336J16C PepBank: Peptide TKPR PeptideDB: ID PEP03385 PubChem: CID 44363090 ZINC: ID ZINC000008659414 |