BIOPEP-UWM: Report
| ID | 2602 |
| Name | Tachykinin family from white shrimp Penaeus vannamei |
| sequence |
| Function: | |||
| Neuropeptide | |||
| Number of residues | 7 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 749.8114 | Monoisotopic mass | 749.3486 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nieto J., Veelaert D., Derua R., Waelkens E., Cerstiaens A., Coast G., Devreese B., Van Beeumen J., Calderon J., De Loof A., Schoofs L. | |
| Title | |
| Identification of one tachykinin and two kinin related peptides in the brain of the white shrimp, Penaeus vannamei. Biochem. Biophys. Res. Comm., 248, 406-411 (1998). | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CO)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1c[nH]c2ccccc12)C(=O)NCC(N)=O InChI=1S/C36H47N9O9/c1-20(37)31(49)43-27(18-46)34(52)41-25(14-21-8-3-2-4-9-21)33(51)44-28(19-47)36(54)45-13-7-12-29(45)35(53)42-26(32(50)40-17-30(38)48)15-22-16-39-24-11-6-5-10-23(22)24/h2-6,8-11,16,20,25-29,39,46-47H,7,12-15,17-19,37H2,1H3,(H2,38,48)(H,40,50)(H,41,52)(H,42,53)(H,43,49)(H,44,51)/t20-,25-,26-,27-,28-,29-/m0/s1 InChIKey: ZYJCGPSCMDBEOE-KOQQHMENSA-N The active form is C-terminal amide. |
| Database reference: |
| EROP-Moscow: ID E02612 |