BIOPEP-UWM: Report
| ID | 2606 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 6 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 688.8556 | Monoisotopic mass | 688.4259 | |
| EC50 : | 10.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal. Biosci. Biotech. Biochem., 56, 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1cnc[nH]1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C34H56N8O7/c1-19(2)13-24(38-29(43)23(35)16-22-17-36-18-37-22)32(46)41-11-7-9-27(41)30(44)39-25(14-20(3)4)33(47)42-12-8-10-28(42)31(45)40-26(34(48)49)15-21(5)6/h17-21,23-28H,7-16,35H2,1-6H3,(H,36,37)(H,38,43)(H,39,44)(H,40,45)(H,48,49)/t23-,24-,25-,26-,27-,28-/m0/s1 InChIKey=YXQGXTCMTANECD-QUQVWLGBSA-N |
| Database reference: |
| EROP-Moscow: ID E14662 |