BIOPEP-UWM: Report
| ID | 2607 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 8 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 977.1502 | Monoisotopic mass | 976.5252 | |
| EC50 : | 30.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal. Biosci. Biotech. Biochem., 56, 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(O)=O InChI=1S/C50H72N8O12/c1-7-30(6)42(50(69)70)56-46(65)39-16-12-23-57(39)48(67)35(21-22-40(60)61)52-47(66)41(29(4)5)55-44(63)36(26-31-13-9-8-10-14-31)53-45(64)38-15-11-24-58(38)49(68)37(27-32-17-19-33(59)20-18-32)54-43(62)34(51)25-28(2)3/h8-10,13-14,17-20,28-30,34-39,41-42,59H,7,11-12,15-16,21-27,51H2,1-6H3,(H,52,66)(H,53,64)(H,54,62)(H,55,63)(H,56,65)(H,60,61)(H,69,70)/t30-,34-,35-,36-,37-,38-,39-,41-,42-/m0/s1 InChIKey: HABAKDPYTFWREO-KDWUJUPASA-N |
| Database reference: |