BIOPEP-UWM: Report
| ID | 2608 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 9 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 1000.1868 | Monoisotopic mass | 999.5412 | |
| EC50 : | 50.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal. Biosci. Biotech. Biochem., 56, 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C52H73N9O11/c1-5-31(3)43(53)48(67)56-37(29-34-20-22-35(62)23-21-34)50(69)60-26-12-18-40(60)46(65)55-36(28-33-14-8-7-9-15-33)49(68)59-25-11-16-38(59)45(64)54-30-42(63)58-24-10-17-39(58)47(66)57-44(32(4)6-2)51(70)61-27-13-19-41(61)52(71)72/h7-9,14-15,20-23,31-32,36-41,43-44,62H,5-6,10-13,16-19,24-30,53H2,1-4H3,(H,54,64)(H,55,65)(H,56,67)(H,57,66)(H,71,72)/t31-,32-,36-,37-,38-,39-,40-,41-,43-,44-/m0/s1 InChIKey: GHSJDPBMKTWWBH-MSEMKWBCSA-N |
| Database reference: |