BIOPEP-UWM: Report
| ID | 2609 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 8 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 901.0115 | Monoisotopic mass | 900.4577 | |
| IC50 : | 280.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal. Biosci. Biotech. Biochem., 56, 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(O)=O InChI=1S/C43H64N8O13/c1-5-24(4)34(44)39(59)46-28(21-25-12-14-26(53)15-13-25)41(61)50-19-7-11-32(50)38(58)48-35(23(2)3)42(62)51-20-8-10-31(51)36(56)45-27(16-17-33(54)55)40(60)49-18-6-9-30(49)37(57)47-29(22-52)43(63)64/h12-15,23-24,27-32,34-35,52-53H,5-11,16-22,44H2,1-4H3,(H,45,56)(H,46,59)(H,47,57)(H,48,58)(H,54,55)(H,63,64)/t24-,27-,28-,29-,30-,31-,32-,34-,35-/m0/s1 InChIKey: POEQXWBIQPDVRI-UICVVSPGSA-N |
| Database reference: |