BIOPEP-UWM: Report
| ID | 2611 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 8 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 903.0719 | Monoisotopic mass | 902.4886 | |
| EC50 : | 25.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal.Biosci.Biotech.Biochem.56(6), 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(O)=O InChI=1S/C47H66N8O10/c1-5-28(3)39(48)44(61)51-34(26-31-18-20-32(56)21-19-31)46(63)55-24-12-17-37(55)42(59)50-33(25-30-13-8-7-9-14-30)45(62)54-23-11-15-35(54)41(58)49-27-38(57)53-22-10-16-36(53)43(60)52-40(47(64)65)29(4)6-2/h7-9,13-14,18-21,28-29,33-37,39-40,56H,5-6,10-12,15-17,22-27,48H2,1-4H3,(H,49,58)(H,50,59)(H,51,61)(H,52,60)(H,64,65)/t28-,29-,33-,34-,35-,36-,37-,39-,40-/m0/s1 InChIKey: KUEQLYMMFZOABS-PENLGRQTSA-N |
| Database reference: |