BIOPEP-UWM: Report
| ID | 2616 |
| Name | PEP inhibitor |
| sequence |
| Function: | |||
| Inhibitor of prolyl oligopeptidase (EC 3.4.21.26) (MEROPS ID: S09.001) | |||
| Number of residues | 8 |
Activity code | am |
| Activity : | antiamnestic |
|||
| Chemical mass | 961.1508 | Monoisotopic mass | 960.5303 | |
| EC50 : | 25.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asano M., Nio N., Ariyoshi Y. | |
| Title | |
| Inhibition of prolyl endopeptidase by synthetic beta-casein peptides and their derivatives with a C-terminal prolinol or prolinal. Biosci. Biotech. Biochem., 56, 976-977 (1992) | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)([C@@H](C)CC)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(O)=O InChI=1S/C50H72N8O11/c1-7-30(5)40(51)46(64)54-36(28-33-19-13-10-14-20-33)49(67)58-26-15-21-37(58)44(62)53-35(27-32-17-11-9-12-18-32)43(61)55-41(29(3)4)47(65)52-34(23-24-39(59)60)48(66)57-25-16-22-38(57)45(63)56-42(50(68)69)31(6)8-2/h9-14,17-20,29-31,34-38,40-42H,7-8,15-16,21-28,51H2,1-6H3,(H,52,65)(H,53,62)(H,54,64)(H,55,61)(H,56,63)(H,59,60)(H,68,69)/t30-,31-,34-,35-,36-,37-,38-,40-,41-,42-/m0/s1 InChIKey: IWDUAPNWNXFCPI-NPFSXUQRSA-N |
| Database reference: |