BIOPEP-UWM: Report
| ID | 2656 |
| Name | synthetic fr. of human beta-CN (161-166) ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 665.8190 | Monoisotopic mass | 665.4099 | |
| EC50 : | 5300.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Kohmura M., Nio N., Kubo K., Minoshima Y., Munekata E., Ariyoshi Y. | |
| Title | |
| Inhibition of angiotensin-converting enzyme by synthetic peptides of human beta-casein. Agric. Biol. Chem., 53(8), 2107-2114 (1989) | |
| Year | Source |
| 1989 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCC(N)=O)C(O)=O InChI=1S/C32H55N7O8/c1-7-19(6)26(31(45)39-15-9-10-22(39)27(41)35-20(32(46)47)12-13-24(33)40)37-28(42)23-11-8-14-38(23)30(44)21(16-17(2)3)36-29(43)25(34)18(4)5/h17-23,25-26H,7-16,34H2,1-6H3,(H2,33,40)(H,35,41)(H,36,43)(H,37,42)(H,46,47)/t19-,20-,21-,22-,23-,25-,26-/m0/s1 InChIKey: JHWMCQQHLVOYEE-DRKCKIEBSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |