BIOPEP-UWM: Report
ID | 2732 |
Name | regulating the frequency of heart muscles contraction peptide |
sequence |
Function: | |||
regulating the frequency of heart muscles contraction | |||
Number of residues | 10 |
Activity code | re |
Activity : | regulating |
|||
Chemical mass | 1103.1429 | Monoisotopic mass | 1102.4607 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Schneider G., Schrodl W., Wallukat G., Muller J., Nissen E., Ronspeck W., Wrede P., Kunze R. | |
Title | |
Peptide design by artificial neural networks and computer-based evolutionary search. Proc. Natl Acad. Sci. USA, 95, 12179-12184, 1998 | |
Year | Source |
1998 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(NC(=O)[C@]([H])(CC1=CN=CN1)NC(=O)[C@]([H])(CC1=CNC2=C1C=CC=C2)NC(=O)[C@]([H])(CC(O)=O)NC(=O)[C@]([H])(C)NC(=O)CNC(=O)CNC(=O)[C@]([H])(Cc1ccccc1)NC(=O)[C@]([H])(CC1=CNC2=C1C=CC=C2)NC(=O)CN)C(O)=O InChI=1S/C53H62N14O13/c1-28(61-45(70)26-58-44(69)25-59-48(74)38(16-30-10-4-3-5-11-30)65-50(76)39(63-43(68)21-54)17-31-22-56-36-14-8-6-12-34(31)36)47(73)64-42(20-46(71)72)52(78)66-40(18-32-23-57-37-15-9-7-13-35(32)37)51(77)67-41(19-33-24-55-27-60-33)49(75)62-29(2)53(79)80/h3-15,22-24,27-29,38-42,56-57H,16-21,25-26,54H2,1-2H3,(H,55,60)(H,58,69)(H,59,74)(H,61,70)(H,62,75)(H,63,68)(H,64,73)(H,65,76)(H,66,78)(H,67,77)(H,71,72)(H,79,80)/t28-,29-,38-,39-,40-,41-,42-/m0/s1 InChIKey=UQVLYZQYWCBKDJ-UQMUMSKGSA-N |
Database reference: |