BIOPEP-UWM: Report
| ID | 2734 |
| Name | peptide regulating the frequency of heart muscles contraction |
| sequence |
| Function: | |||
| regulating the frequency of heart muscles contraction | |||
| Number of residues | 10 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 1225.4001 | Monoisotopic mass | 1224.5475 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Schneider G., Schrodl W., Wallukat G., Muller J., Nissen E., Ronspeck W., Wrede P., Kunze R. | |
| Title | |
| Peptide design by artificial neural networks and computer-based evolutionary search. Proc. Natl Acad. Sci. USA, 95, 12179-12184, 1998 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CS)C(O)=O InChI=1S/C49H80N18O15S2/c1-24(51)38(72)59-28(8-4-16-57-48(53)54)39(73)60-29(9-5-17-58-49(55)56)40(74)65-33(22-83)44(78)62-30(19-25-11-13-26(68)14-12-25)42(76)63-31(20-36(52)69)43(77)64-32(21-37(70)71)46(80)67-18-6-10-35(67)45(79)61-27(7-2-3-15-50)41(75)66-34(23-84)47(81)82/h11-14,24,27-35,68,83-84H,2-10,15-23,50-51H2,1H3,(H2,52,69)(H,59,72)(H,60,73)(H,61,79)(H,62,78)(H,63,76)(H,64,77)(H,65,74)(H,66,75)(H,70,71)(H,81,82)(H4,53,54,57)(H4,55,56,58)/t24-,27-,28-,29-,30-,31-,32-,33-,34-,35-/m0/s1 InChIKey=FJJIHJFRRLJUDP-ZVDJGHCHSA-N |
| Database reference: |