BIOPEP-UWM: Report
| ID | 2737 |
| Name | Peptide regulating phosphoinositol metabolism |
| sequence |
| Function: | |||
| regulating phosphoinositol metabolism | |||
| Number of residues | 3 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Migliore-Samour D., Roch-Arveiller M., Tissot M., Jazziri M., Keddad K., Giroud J-P., Jolles P. | |
| Title | |
| Effects of tripeptides derived from milk proteins on polymorphonuclear oxidative and phosphoinositide metabolisms. Biochem. Pharmacol., 44, 673-680, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)[C@]([H])(Cc1ccccc1)NC(=O)CN)C(O)=O InChI=1S/C17H25N3O4/c1-11(2)8-14(17(23)24)20-16(22)13(19-15(21)10-18)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)/t13-,14-/m0/s1 InChIKey=JPVGHHQGKPQYIL-KBPBESRZSA-N Immunostimulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3061); the EROP-Moscow database (ID E14546), the MBPDB database Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9512) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 3061; 9512 ChemSpider: ID 5379095 EROP-Moscow: ID E14546, E09274 MBPDB: Peptide GFL MolInstincts: Compound Gly-L-Phe-L-Leu-OH PubChem: CID 7016073 |