BIOPEP-UWM: Report
| ID | 2739 |
| Name | Peptide regulating phosphoinositol metabolism |
| sequence |
| Function: | |||
| regulating phosphoinositol metabolism | |||
| Number of residues | 3 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 351.3965 | Monoisotopic mass | 351.1788 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Migliore-Samour D., Roch-Arveiller M., Tissot M., Jazziri M., Keddad K., Giroud J-P., Jolles P. | |
| Title | |
| Effects of tripeptides derived from milk proteins on polymorphonuclear oxidative and phosphoinositide metabolisms. Biochem. Pharmacol., 44, 673-680, 1992 | |
| Year | Source |
| 1992 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)CN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C17H25N3O5/c1-10(2)7-13(19-15(22)9-18)16(23)20-14(17(24)25)8-11-3-5-12(21)6-4-11/h3-6,10,13-14,21H,7-9,18H2,1-2H3,(H,19,22)(H,20,23)(H,24,25)/t13-,14-/m0/s1 InChIKey=AFWYPMDMDYCKMD-KBPBESRZSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 9033); the EROP-Moscow database; Immunostimulating peptide according to the EROP-Moscow database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids, the ChEMBL database |
| Database reference: |
| AHTPDB: ID 1548, 2682 BIOPEP-UWM database of bioactive peptides: ID 9033 BIOPEP-UWM database of sensory peptides and amino acids: ID 479 Brenda: Ligand Gly-Leu-Tyr ChEMBL: ID CHEMBL55636 ChemIDplus: ID 004306245 ChemSpider: ID 87417 EROP-Moscow: ID E09275 J-GLOBAL: ID 200907057286269771 Nikkaji: ID J151.045B PubChem: CID 6992403 SATPdb: ID satpdb12559 SureChEMBL: ID SCHEMBL10520794 ZINC: ID ZINC000001575534 |