BIOPEP-UWM: Report
ID | 2740 |
Name | Peptide regulating phosphoinositol metabolism |
sequence |
Function: | |||
regulating phosphoinositol metabolism | |||
Number of residues | 3 |
Activity code | re |
Activity : | regulating |
|||
Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Migliore-Samour D., Roch-Arveiller M., Tissot M., Jazziri M., Keddad K., Giroud J-P., Jolles P. | |
Title | |
Effects of tripeptides derived from milk proteins on polymorphonuclear oxidative and phosphoinositide metabolisms. Biochem. Pharmacol., 44, 673-680, 1992 | |
Year | Source |
1992 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CC(C)C)(NC(=O)CN)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C17H25N3O4/c1-11(2)8-13(19-15(21)10-18)16(22)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)/t13-,14-/m0/s1 InChIKey=TVUWMSBGMVAHSJ-KBPBESRZSA-N Immunostimulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9386), the EROP-Moscow database |
Database reference: |
ACToR: ID 103213-38-3 BindingDB: ID 50188525 BIOPEP-UWM database of bioactive peptides: ID 9386 ChEMBL: ID CHEMBL209670 ChemIDplus: ID 103213383 ChemSpider: ID 113733 EROP-Moscow: ID E01883 J-GLOBAL: ID 200907092951841791 Nikkaji: ID J492.337E PubChem: CID 128287 SureChEMBL: ID SCHEMBL4281374 ZINC: ID ZINC000002522593 |