BIOPEP-UWM: Report
| ID | 2745 |
| Name | peptide activating kinases and phosphatases |
| sequence |
| Function: | |||
| regulating of activity of kinases and phosphatases | |||
| Number of residues | 9 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 1108.1543 | Monoisotopic mass | 1107.4856 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gram H., Schmitz R., Zuber J. F., Baumann G., 1997 | |
| Title | |
| Identification of phosphopeptide ligands fo the Src-homology 2 (SH2) domain of Grb2 by phage display. Eur. J. Biochem., 246, 633-637, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(O)=O InChI=1S/C51H69N11O17/c1-26(2)42(50(77)62-21-7-11-37(62)48(75)59-35(51(78)79)25-41(68)69)60-46(73)34(24-39(54)65)57-43(70)31(17-18-38(53)64)55-44(71)32(23-28-12-14-29(63)15-13-28)56-45(72)33(22-27-8-4-3-5-9-27)58-47(74)36-10-6-20-61(36)49(76)30(52)16-19-40(66)67/h3-5,8-9,12-15,26,30-37,42,63H,6-7,10-11,16-25,52H2,1-2H3,(H2,53,64)(H2,54,65)(H,55,71)(H,56,72)(H,57,70)(H,58,74)(H,59,75)(H,60,73)(H,66,67)(H,68,69)(H,78,79)/t30-,31-,32-,33-,34-,35-,36-,37-,42-/m0/s1 InChIKey=QNKZPIXOVHWXNN-HFRCKLQCSA-N |
| Database reference: |