BIOPEP-UWM: Report
| ID | 2752 |
| Name | peptide activating kinases and phosphatases |
| sequence |
| Function: | |||
| regulating activities of kinases and phosphatases | |||
| Number of residues | 8 |
Activity code | re |
| Activity : | regulating |
|||
| Chemical mass | 920.9600 | Monoisotopic mass | 920.4225 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gram H., Schmitz R., Zuber J. F., Baumann G. | |
| Title | |
| Identification of phosphopeptide ligands fo the Src-homology 2 (SH2) domain of Grb2 by phage display. Eur. J. Biochem., 246, 633-637, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(N)=O)C(O)=O InChI=1S/C40H60N10O15/c1-18(2)31(37(61)44-23(40(64)65)11-12-28(42)53)49-34(58)25(16-29(43)54)46-38(62)32(19(3)4)48-33(57)24(14-20-7-9-21(52)10-8-20)45-35(59)26(17-51)47-36(60)27-6-5-13-50(27)39(63)22(41)15-30(55)56/h7-10,18-19,22-27,31-32,51-52H,5-6,11-17,41H2,1-4H3,(H2,42,53)(H2,43,54)(H,44,61)(H,45,59)(H,46,62)(H,47,60)(H,48,57)(H,49,58)(H,55,56)(H,64,65)/t22-,23-,24-,25-,26-,27-,31-,32-/m0/s1 InChIKey=JXDSPHZOHAQUHI-FIOLWHMYSA-N |
| Database reference: |