BIOPEP-UWM: Report
| ID | 2770 |
| Name | Heparin binding peptide |
| sequence |
| Function: | |||
| Promoting cancer cel adhesion | |||
| Number of residues | 8 |
Activity code | bin |
| Activity : | binding |
|||
| Chemical mass | 1023.1887 | Monoisotopic mass | 1022.5758 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Mohri H. | |
| Title | |
| Interaction of fibronectin with integrin receptors: evidence by use synthetic peptides. Peptides, 18, 899-908, 1997 | |
| Year | Source |
| 1997 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC1=CNC2=C1C=CC=C2)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])([C@@H](C)CC)C(O)=O InChI=1S/C47H74N16O10/c1-4-25(2)37(45(72)73)61-41(68)32(14-8-20-55-47(52)53)58-38(65)26(3)57-40(67)31(13-7-19-54-46(50)51)59-42(69)34-15-9-21-62(34)44(71)35-16-10-22-63(35)43(70)33(17-18-36(49)64)60-39(66)29(48)23-27-24-56-30-12-6-5-11-28(27)30/h5-6,11-12,24-26,29,31-35,37,56H,4,7-10,13-23,48H2,1-3H3,(H2,49,64)(H,57,67)(H,58,65)(H,59,69)(H,60,66)(H,61,68)(H,72,73)(H4,50,51,54)(H4,52,53,55)/t25-,26-,29-,31-,32-,33-,34-,35-,37-/m0/s1 InChIKey=OVXIMRGEBNSORH-PJRZOMOUSA-N |
| Database reference: |
| ChemSpider: ID 7987680 EPA DSSTox: ID DTXCID90381830 PubChem: CID 9811927 |