BIOPEP-UWM: Report
| ID | 2775 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Inhibitor of HIV-1 retropepsin (EC 3.4.23.16) (MEROPS ID: A02.001) | |||
| Number of residues | 4 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 536.6162 | Monoisotopic mass | 536.2836 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee T. G., Maruyama S. | |
| Title | |
| Isolation of HIV-1 protease-inhibiting peptide from thermolysin hydrolysate of oyster proteins. Biochem. Biophys. Res. Commun., 253, 604-608, 1998 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(O)=O InChI=1S/C26H40N4O8/c1-14(2)11-18(27)23(34)29-20(12-15(3)4)25(36)28-19(9-10-22(32)33)24(35)30-21(26(37)38)13-16-5-7-17(31)8-6-16/h5-8,14-15,18-21,31H,9-13,27H2,1-4H3,(H,28,36)(H,29,34)(H,30,35)(H,32,33)(H,37,38)/t18-,19-,20-,21-/m0/s1 InChIKey=RGARGDSIPNVFAN-TUFLPTIASA-N |
| Database reference: |