BIOPEP-UWM: Report
| ID | 2791 |
| Name | precursor of thyrotropin hormone (1-6) |
| sequence |
| Function: | |||
| Neuropeptide | |||
| Number of residues | 6 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 721.8062 | Monoisotopic mass | 721.3973 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jackson I. M. D., Wu P., Lechan R. M. | |
| Title | |
| Immunohistochemical localization in the rat brain of the precursor of thyrotropin releasing hormone. Science, 229, 1097-1099, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCCN)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(O)=O InChI=1S/C30H51N13O8/c31-10-2-1-5-18(32)25(47)40-19(6-3-11-37-30(34)35)26(48)41-20(8-9-23(33)44)27(49)42-21(13-17-14-36-16-39-17)29(51)43-12-4-7-22(43)28(50)38-15-24(45)46/h14,16,18-22H,1-13,15,31-32H2,(H2,33,44)(H,36,39)(H,38,50)(H,40,47)(H,41,48)(H,42,49)(H,45,46)(H4,34,35,37)/t18-,19-,20-,21-,22-/m0/s1 InChIKey=HFNLESLXLUHNSI-YFNVTMOMSA-N |
| Database reference: |
| ChemSpider: ID 57265125 |